C15H14N4S2 — CID 127030914
1-(4-cyanophenyl)-3-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)thiourea (PubChem CID 127030914) has the molecular formula C15H14N4S2 and a molecular weight of 314.44 g/mol. Its IUPAC name is 1-(4-cyanophenyl)-3-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)thiourea.
| Compound Name | 1-(4-cyanophenyl)-3-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)thiourea |
|---|---|
| PubChem CID | 127030914 |
| Molecular Formula | C15H14N4S2 |
| Molecular Weight | 314.44 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | 1-(4-cyanophenyl)-3-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)thiourea |
| SMILES | N#Cc1ccc(NC(=S)Nc2nc3c(s2)CCCC3)cc1 |
| InChI | InChI=1S/C15H14N4S2/c16-9-10-5-7-11(8-6-10)17-14(20)19-15-18-12-3-1-2-4-13(12)21-15/h5-8H,1-4H2,(H2,17,18,19,20) |
| InChIKey | URUVGECUDIAARF-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 60.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.44 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|