About 1,3-dimethyl-2-(1H-pyrrol-3-yl)-2,4-dihydroquinazolin-6-ol
1,3-dimethyl-2-(1H-pyrrol-3-yl)-2,4-dihydroquinazolin-6-ol (PubChem CID 127030955) has the molecular formula C14H17N3O
and a molecular weight of 243.31 g/mol. Its IUPAC name is 1,3-dimethyl-2-(1H-pyrrol-3-yl)-2,4-dihydroquinazolin-6-ol.
Molecular Properties
| Compound Name | 1,3-dimethyl-2-(1H-pyrrol-3-yl)-2,4-dihydroquinazolin-6-ol |
| PubChem CID | 127030955 |
| Molecular Formula | C14H17N3O |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | 1,3-dimethyl-2-(1H-pyrrol-3-yl)-2,4-dihydroquinazolin-6-ol |
| SMILES | CN1Cc2cc(O)ccc2N(C)C1c1cc[nH]c1 |
| InChI | InChI=1S/C14H17N3O/c1-16-9-11-7-12(18)3-4-13(11)17(2)14(16)10-5-6-15-8-10/h3-8,14-15,18H,9H2,1-2H3 |
| InChIKey | VCQQBALKFNTEFM-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 42.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,3-dimethyl-2-(1H-pyrrol-3-yl)-2,4-dihydroquinazolin-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethyl-2-(1H-pyrrol-3-yl)-2,4-dihydroquinazolin-6-ol?
The IUPAC name of 1,3-dimethyl-2-(1H-pyrrol-3-yl)-2,4-dihydroquinazolin-6-ol (CID 127030955) is 1,3-dimethyl-2-(1H-pyrrol-3-yl)-2,4-dihydroquinazolin-6-ol.
What is the SMILES notation for 1,3-dimethyl-2-(1H-pyrrol-3-yl)-2,4-dihydroquinazolin-6-ol?
The canonical SMILES for 1,3-dimethyl-2-(1H-pyrrol-3-yl)-2,4-dihydroquinazolin-6-ol is CN1Cc2cc(O)ccc2N(C)C1c1cc[nH]c1.
What is the InChIKey of 1,3-dimethyl-2-(1H-pyrrol-3-yl)-2,4-dihydroquinazolin-6-ol?
The InChIKey is VCQQBALKFNTEFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17N3O/c1-16-9-11-7-12(18)3-4-13(11)17(2)14(16)10-5-6-15-8-10/h3-8,14-15,18H,9H2,1-2H3.
What are the key properties of 1,3-dimethyl-2-(1H-pyrrol-3-yl)-2,4-dihydroquinazolin-6-ol?
1,3-dimethyl-2-(1H-pyrrol-3-yl)-2,4-dihydroquinazolin-6-ol has a molecular weight of 243.31 g/mol, XLogP of 2.30, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethyl-2-(1H-pyrrol-3-yl)-2,4-dihydroquinazolin-6-ol is sourced from PubChem (CID 127030955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).