C29H46O4 — CID 127030975
(1R,2R,5R,12S,15R,16R,22R)-5-hydroxy-1,2,8,8,16,21,21-heptamethyl-10,20-dioxahexacyclo[13.9.0.02,12.05,11.09,11.016,22]tetracosan-19-one (PubChem CID 127030975) has the molecular formula C29H46O4 and a molecular weight of 458.68 g/mol. Its IUPAC name is (1R,2R,5R,12S,15R,16R,22R)-5-hydroxy-1,2,8,8,16,21,21-heptamethyl-10,20-dioxahexacyclo[13.9.0.02,12.05,11.09,11.016,22]tetracosan-19-one.
| Compound Name | (1R,2R,5R,12S,15R,16R,22R)-5-hydroxy-1,2,8,8,16,21,21-heptamethyl-10,20-dioxahexacyclo[13.9.0.02,12.05,11.09,11.016,22]tetracosan-19-one |
|---|---|
| PubChem CID | 127030975 |
| Molecular Formula | C29H46O4 |
| Molecular Weight | 458.68 g/mol |
| Exact Mass | 458.34 |
| IUPAC Name | (1R,2R,5R,12S,15R,16R,22R)-5-hydroxy-1,2,8,8,16,21,21-heptamethyl-10,20-dioxahexacyclo[13.9.0.02,12.05,11.09,11.016,22]tetracosan-19-one |
| SMILES | CC1(C)CC[C@]2(O)CC[C@]3(C)[C@H](CC[C@@H]4[C@@]5(C)CCC(=O)OC(C)(C)[C@@H]5CC[C@]43C)C23OC13 |
| InChI | InChI=1S/C29H46O4/c1-23(2)14-16-28(31)17-15-27(7)20(29(28)22(23)33-29)9-8-19-25(5)12-11-21(30)32-24(3,4)18(25)10-13-26(19,27)6/h18-20,22,31H,8-17H2,1-7H3/t18-,19+,20-,22?,25-,26+,27+,28-,29?/m0/s1 |
| InChIKey | DOAXZARAIUMPNY-HVBBLLJDSA-N |
| XLogP | 6.04 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.68 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|