C21H23N7O2 — CID 127031072
N-[4-(4-methylpiperazin-1-yl)phenyl]-2-oxo-4-(pyrimidin-4-ylamino)-1H-pyridine-3-carboxamide (PubChem CID 127031072) has the molecular formula C21H23N7O2 and a molecular weight of 405.46 g/mol. Its IUPAC name is N-[4-(4-methylpiperazin-1-yl)phenyl]-2-oxo-4-(pyrimidin-4-ylamino)-1H-pyridine-3-carboxamide.
| Compound Name | N-[4-(4-methylpiperazin-1-yl)phenyl]-2-oxo-4-(pyrimidin-4-ylamino)-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 127031072 |
| Molecular Formula | C21H23N7O2 |
| Molecular Weight | 405.46 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | N-[4-(4-methylpiperazin-1-yl)phenyl]-2-oxo-4-(pyrimidin-4-ylamino)-1H-pyridine-3-carboxamide |
| SMILES | CN1CCN(c2ccc(NC(=O)c3c(Nc4ccncn4)cc[nH]c3=O)cc2)CC1 |
| InChI | InChI=1S/C21H23N7O2/c1-27-10-12-28(13-11-27)16-4-2-15(3-5-16)25-21(30)19-17(6-9-23-20(19)29)26-18-7-8-22-14-24-18/h2-9,14H,10-13H2,1H3,(H,25,30)(H2,22,23,24,26,29) |
| InChIKey | ZMDBPJYOYRDINU-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 106.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.46 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|