C19H18BrN3 — CID 127031092
(1R,9R)-4-amino-6-(4-bromophenyl)-10,10-dimethyl-3-azatricyclo[7.1.1.02,7]undeca-2,4,6-triene-5-carbonitrile (PubChem CID 127031092) has the molecular formula C19H18BrN3 and a molecular weight of 368.28 g/mol. Its IUPAC name is (1R,9R)-4-amino-6-(4-bromophenyl)-10,10-dimethyl-3-azatricyclo[7.1.1.02,7]undeca-2,4,6-triene-5-carbonitrile.
| Compound Name | (1R,9R)-4-amino-6-(4-bromophenyl)-10,10-dimethyl-3-azatricyclo[7.1.1.02,7]undeca-2,4,6-triene-5-carbonitrile |
|---|---|
| PubChem CID | 127031092 |
| Molecular Formula | C19H18BrN3 |
| Molecular Weight | 368.28 g/mol |
| Exact Mass | 367.07 |
| IUPAC Name | (1R,9R)-4-amino-6-(4-bromophenyl)-10,10-dimethyl-3-azatricyclo[7.1.1.02,7]undeca-2,4,6-triene-5-carbonitrile |
| SMILES | CC1(C)[C@H]2Cc3c(nc(N)c(C#N)c3-c3ccc(Br)cc3)[C@@H]1C2 |
| InChI | InChI=1S/C19H18BrN3/c1-19(2)11-7-13-16(10-3-5-12(20)6-4-10)14(9-21)18(22)23-17(13)15(19)8-11/h3-6,11,15H,7-8H2,1-2H3,(H2,22,23)/t11-,15-/m0/s1 |
| InChIKey | MIJFVTMTJMXNRW-NHYWBVRUSA-N |
| XLogP | 4.65 |
| TPSA | 62.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.28 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |