About CID 12703126
CID 12703126 (PubChem CID 12703126) has the molecular formula C8H11O
and a molecular weight of 123.17 g/mol.
Molecular Properties
| Compound Name | CID 12703126 |
| PubChem CID | 12703126 |
| Molecular Formula | C8H11O |
| Molecular Weight | 123.17 g/mol |
| Exact Mass | 123.08 |
| IUPAC Name | — |
| SMILES | COC1=CC=C(C)C[CH]1 |
| InChI | InChI=1S/C8H11O/c1-7-3-5-8(9-2)6-4-7/h3,5-6H,4H2,1-2H3 |
| InChIKey | POBNREMHNGBVTJ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 123.17 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 12703126 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 12703126?
The IUPAC name of CID 12703126 (CID 12703126) is not available.
What is the SMILES notation for CID 12703126?
The canonical SMILES for CID 12703126 is COC1=CC=C(C)C[CH]1.
What is the InChIKey of CID 12703126?
The InChIKey is POBNREMHNGBVTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11O/c1-7-3-5-8(9-2)6-4-7/h3,5-6H,4H2,1-2H3.
What are the key properties of CID 12703126?
CID 12703126 has a molecular weight of 123.17 g/mol, XLogP of 2.07, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 12703126 is sourced from PubChem (CID 12703126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).