About (2R,3R)-5-methoxy-2-(4-methoxyphenyl)-3-(4-phenylphenyl)-2,3-dihydroinden-1-one
(2R,3R)-5-methoxy-2-(4-methoxyphenyl)-3-(4-phenylphenyl)-2,3-dihydroinden-1-one (PubChem CID 127031318) has the molecular formula C29H24O3
and a molecular weight of 420.51 g/mol. Its IUPAC name is (2R,3R)-5-methoxy-2-(4-methoxyphenyl)-3-(4-phenylphenyl)-2,3-dihydroinden-1-one.
Molecular Properties
| Compound Name | (2R,3R)-5-methoxy-2-(4-methoxyphenyl)-3-(4-phenylphenyl)-2,3-dihydroinden-1-one |
| PubChem CID | 127031318 |
| Molecular Formula | C29H24O3 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | (2R,3R)-5-methoxy-2-(4-methoxyphenyl)-3-(4-phenylphenyl)-2,3-dihydroinden-1-one |
| SMILES | COc1ccc([C@@H]2C(=O)c3ccc(OC)cc3[C@H]2c2ccc(-c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C29H24O3/c1-31-23-14-12-22(13-15-23)28-27(26-18-24(32-2)16-17-25(26)29(28)30)21-10-8-20(9-11-21)19-6-4-3-5-7-19/h3-18,27-28H,1-2H3/t27-,28+/m1/s1 |
| InChIKey | KJCOQHMHDBWKMR-IZLXSDGUSA-N |
| XLogP | 6.48 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2R,3R)-5-methoxy-2-(4-methoxyphenyl)-3-(4-phenylphenyl)-2,3-dihydroinden-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,3R)-5-methoxy-2-(4-methoxyphenyl)-3-(4-phenylphenyl)-2,3-dihydroinden-1-one?
The IUPAC name of (2R,3R)-5-methoxy-2-(4-methoxyphenyl)-3-(4-phenylphenyl)-2,3-dihydroinden-1-one (CID 127031318) is (2R,3R)-5-methoxy-2-(4-methoxyphenyl)-3-(4-phenylphenyl)-2,3-dihydroinden-1-one.
What is the SMILES notation for (2R,3R)-5-methoxy-2-(4-methoxyphenyl)-3-(4-phenylphenyl)-2,3-dihydroinden-1-one?
The canonical SMILES for (2R,3R)-5-methoxy-2-(4-methoxyphenyl)-3-(4-phenylphenyl)-2,3-dihydroinden-1-one is COc1ccc([C@@H]2C(=O)c3ccc(OC)cc3[C@H]2c2ccc(-c3ccccc3)cc2)cc1.
What is the InChIKey of (2R,3R)-5-methoxy-2-(4-methoxyphenyl)-3-(4-phenylphenyl)-2,3-dihydroinden-1-one?
The InChIKey is KJCOQHMHDBWKMR-IZLXSDGUSA-N. The full InChI is InChI=1S/C29H24O3/c1-31-23-14-12-22(13-15-23)28-27(26-18-24(32-2)16-17-25(26)29(28)30)21-10-8-20(9-11-21)19-6-4-3-5-7-19/h3-18,27-28H,1-2H3/t27-,28+/m1/s1.
What are the key properties of (2R,3R)-5-methoxy-2-(4-methoxyphenyl)-3-(4-phenylphenyl)-2,3-dihydroinden-1-one?
(2R,3R)-5-methoxy-2-(4-methoxyphenyl)-3-(4-phenylphenyl)-2,3-dihydroinden-1-one has a molecular weight of 420.51 g/mol, XLogP of 6.48, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,3R)-5-methoxy-2-(4-methoxyphenyl)-3-(4-phenylphenyl)-2,3-dihydroinden-1-one is sourced from PubChem (CID 127031318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).