About cis-(1S,2S)-1-[(4-chlorophenyl)methyl]-2-phenylcyclopropane-1-carboxylic acid
cis-(1S,2S)-1-[(4-chlorophenyl)methyl]-2-phenylcyclopropane-1-carboxylic acid (PubChem CID 127031563) has the molecular formula C17H15ClO2
and a molecular weight of 286.76 g/mol. Its IUPAC name is cis-(1S,2S)-1-[(4-chlorophenyl)methyl]-2-phenylcyclopropane-1-carboxylic acid.
Molecular Properties
| Compound Name | cis-(1S,2S)-1-[(4-chlorophenyl)methyl]-2-phenylcyclopropane-1-carboxylic acid |
| PubChem CID | 127031563 |
| Molecular Formula | C17H15ClO2 |
| Molecular Weight | 286.76 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | cis-(1S,2S)-1-[(4-chlorophenyl)methyl]-2-phenylcyclopropane-1-carboxylic acid |
| SMILES | O=C(O)[C@]1(Cc2ccc(Cl)cc2)C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C17H15ClO2/c18-14-8-6-12(7-9-14)10-17(16(19)20)11-15(17)13-4-2-1-3-5-13/h1-9,15H,10-11H2,(H,19,20)/t15-,17+/m0/s1 |
| InChIKey | YYNYJPGIQKBATL-DOTOQJQBSA-N |
| XLogP | 4.14 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.76 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze cis-(1S,2S)-1-[(4-chlorophenyl)methyl]-2-phenylcyclopropane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(1S,2S)-1-[(4-chlorophenyl)methyl]-2-phenylcyclopropane-1-carboxylic acid?
The IUPAC name of cis-(1S,2S)-1-[(4-chlorophenyl)methyl]-2-phenylcyclopropane-1-carboxylic acid (CID 127031563) is cis-(1S,2S)-1-[(4-chlorophenyl)methyl]-2-phenylcyclopropane-1-carboxylic acid.
What is the SMILES notation for cis-(1S,2S)-1-[(4-chlorophenyl)methyl]-2-phenylcyclopropane-1-carboxylic acid?
The canonical SMILES for cis-(1S,2S)-1-[(4-chlorophenyl)methyl]-2-phenylcyclopropane-1-carboxylic acid is O=C(O)[C@]1(Cc2ccc(Cl)cc2)C[C@H]1c1ccccc1.
What is the InChIKey of cis-(1S,2S)-1-[(4-chlorophenyl)methyl]-2-phenylcyclopropane-1-carboxylic acid?
The InChIKey is YYNYJPGIQKBATL-DOTOQJQBSA-N. The full InChI is InChI=1S/C17H15ClO2/c18-14-8-6-12(7-9-14)10-17(16(19)20)11-15(17)13-4-2-1-3-5-13/h1-9,15H,10-11H2,(H,19,20)/t15-,17+/m0/s1.
What are the key properties of cis-(1S,2S)-1-[(4-chlorophenyl)methyl]-2-phenylcyclopropane-1-carboxylic acid?
cis-(1S,2S)-1-[(4-chlorophenyl)methyl]-2-phenylcyclopropane-1-carboxylic acid has a molecular weight of 286.76 g/mol, XLogP of 4.14, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(1S,2S)-1-[(4-chlorophenyl)methyl]-2-phenylcyclopropane-1-carboxylic acid is sourced from PubChem (CID 127031563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).