C36H57NO2 — CID 127031581
(4aS,6aR,6aR,6bR,8aR,12aR,14aS)-N-cyclohexyl-2,2,6a,6b,9,9,12a-heptamethyl-10-oxo-4,5,6,6a,7,8,8a,11,12,13,14,14a-dodecahydro-3H-picene-4a-carboxamide (PubChem CID 127031581) has the molecular formula C36H57NO2 and a molecular weight of 535.86 g/mol. Its IUPAC name is (4aS,6aR,6aR,6bR,8aR,12aR,14aS)-N-cyclohexyl-2,2,6a,6b,9,9,12a-heptamethyl-10-oxo-4,5,6,6a,7,8,8a,11,12,13,14,14a-dodecahydro-3H-picene-4a-carboxamide.
| Compound Name | (4aS,6aR,6aR,6bR,8aR,12aR,14aS)-N-cyclohexyl-2,2,6a,6b,9,9,12a-heptamethyl-10-oxo-4,5,6,6a,7,8,8a,11,12,13,14,14a-dodecahydro-3H-picene-4a-carboxamide |
|---|---|
| PubChem CID | 127031581 |
| Molecular Formula | C36H57NO2 |
| Molecular Weight | 535.86 g/mol |
| Exact Mass | 535.44 |
| IUPAC Name | (4aS,6aR,6aR,6bR,8aR,12aR,14aS)-N-cyclohexyl-2,2,6a,6b,9,9,12a-heptamethyl-10-oxo-4,5,6,6a,7,8,8a,11,12,13,14,14a-dodecahydro-3H-picene-4a-carboxamide |
| SMILES | CC1(C)C=C2[C@H]3CC[C@@H]4[C@@]5(C)CCC(=O)C(C)(C)[C@@H]5CC[C@@]4(C)[C@]3(C)CC[C@@]2(C(=O)NC2CCCCC2)CC1 |
| InChI | InChI=1S/C36H57NO2/c1-31(2)19-21-36(30(39)37-24-11-9-8-10-12-24)22-20-34(6)25(26(36)23-31)13-14-28-33(5)17-16-29(38)32(3,4)27(33)15-18-35(28,34)7/h23-25,27-28H,8-22H2,1-7H3,(H,37,39)/t25-,27+,28-,33+,34-,35-,36+/m1/s1 |
| InChIKey | RIRQZJVPSPDAQB-MYRVBJLKSA-N |
| XLogP | 8.81 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.86 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|