C19H25N3O — CID 127031596
N,N-dimethyl-3-[(2-phenyl-5,6,7,8-tetrahydroquinazolin-4-yl)oxy]propan-1-amine (PubChem CID 127031596) has the molecular formula C19H25N3O and a molecular weight of 311.43 g/mol. Its IUPAC name is N,N-dimethyl-3-[(2-phenyl-5,6,7,8-tetrahydroquinazolin-4-yl)oxy]propan-1-amine.
| Compound Name | N,N-dimethyl-3-[(2-phenyl-5,6,7,8-tetrahydroquinazolin-4-yl)oxy]propan-1-amine |
|---|---|
| PubChem CID | 127031596 |
| Molecular Formula | C19H25N3O |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.20 |
| IUPAC Name | N,N-dimethyl-3-[(2-phenyl-5,6,7,8-tetrahydroquinazolin-4-yl)oxy]propan-1-amine |
| SMILES | CN(C)CCCOc1nc(-c2ccccc2)nc2c1CCCC2 |
| InChI | InChI=1S/C19H25N3O/c1-22(2)13-8-14-23-19-16-11-6-7-12-17(16)20-18(21-19)15-9-4-3-5-10-15/h3-5,9-10H,6-8,11-14H2,1-2H3 |
| InChIKey | COEAUKQAMJEJON-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|