C31H25N5OS — CID 127031706
N-[(E)-[3-(1-benzofuran-2-yl)-1-phenylpyrazol-4-yl]methylideneamino]-4-(5,6,7,8-tetrahydronaphthalen-2-yl)-1,3-thiazol-2-amine (PubChem CID 127031706) has the molecular formula C31H25N5OS and a molecular weight of 515.64 g/mol. Its IUPAC name is N-[(E)-[3-(1-benzofuran-2-yl)-1-phenylpyrazol-4-yl]methylideneamino]-4-(5,6,7,8-tetrahydronaphthalen-2-yl)-1,3-thiazol-2-amine.
| Compound Name | N-[(E)-[3-(1-benzofuran-2-yl)-1-phenylpyrazol-4-yl]methylideneamino]-4-(5,6,7,8-tetrahydronaphthalen-2-yl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 127031706 |
| Molecular Formula | C31H25N5OS |
| Molecular Weight | 515.64 g/mol |
| Exact Mass | 515.18 |
| IUPAC Name | N-[(E)-[3-(1-benzofuran-2-yl)-1-phenylpyrazol-4-yl]methylideneamino]-4-(5,6,7,8-tetrahydronaphthalen-2-yl)-1,3-thiazol-2-amine |
| SMILES | C(=N/Nc1nc(-c2ccc3c(c2)CCCC3)cs1)\c1cn(-c2ccccc2)nc1-c1cc2ccccc2o1 |
| InChI | InChI=1S/C31H25N5OS/c1-2-11-26(12-3-1)36-19-25(30(35-36)29-17-24-10-6-7-13-28(24)37-29)18-32-34-31-33-27(20-38-31)23-15-14-21-8-4-5-9-22(21)16-23/h1-3,6-7,10-20H,4-5,8-9H2,(H,33,34)/b32-18+ |
| InChIKey | DNSODRDTBVCASW-KCSSXMTESA-N |
| XLogP | 7.73 |
| TPSA | 68.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.64 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|