C35H44N4O4 — CID 127031902
tert-butyl N-[(2R)-1-(2,2-diphenylethylamino)-1-oxo-6-[[(3S)-1,2,3,4-tetrahydroisoquinoline-3-carbonyl]amino]hexan-2-yl]carbamate (PubChem CID 127031902) has the molecular formula C35H44N4O4 and a molecular weight of 584.76 g/mol. Its IUPAC name is tert-butyl N-[(2R)-1-(2,2-diphenylethylamino)-1-oxo-6-[[(3S)-1,2,3,4-tetrahydroisoquinoline-3-carbonyl]amino]hexan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-1-(2,2-diphenylethylamino)-1-oxo-6-[[(3S)-1,2,3,4-tetrahydroisoquinoline-3-carbonyl]amino]hexan-2-yl]carbamate |
|---|---|
| PubChem CID | 127031902 |
| Molecular Formula | C35H44N4O4 |
| Molecular Weight | 584.76 g/mol |
| Exact Mass | 584.34 |
| IUPAC Name | tert-butyl N-[(2R)-1-(2,2-diphenylethylamino)-1-oxo-6-[[(3S)-1,2,3,4-tetrahydroisoquinoline-3-carbonyl]amino]hexan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H](CCCCNC(=O)[C@@H]1Cc2ccccc2CN1)C(=O)NCC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C35H44N4O4/c1-35(2,3)43-34(42)39-30(20-12-13-21-36-33(41)31-22-27-18-10-11-19-28(27)23-37-31)32(40)38-24-29(25-14-6-4-7-15-25)26-16-8-5-9-17-26/h4-11,14-19,29-31,37H,12-13,20-24H2,1-3H3,(H,36,41)(H,38,40)(H,39,42)/t30-,31+/m1/s1 |
| InChIKey | HCTPDRHGXRHJAA-JSOSNVBQSA-N |
| XLogP | 4.83 |
| TPSA | 108.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.76 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|