About 3-morpholin-4-ylpropyl N-[3-[(6-methyl-2-oxo-1,3-benzoxazol-3-yl)methyl]phenyl]carbamate
3-morpholin-4-ylpropyl N-[3-[(6-methyl-2-oxo-1,3-benzoxazol-3-yl)methyl]phenyl]carbamate (PubChem CID 127031937) has the molecular formula C23H27N3O5
and a molecular weight of 425.49 g/mol. Its IUPAC name is 3-morpholin-4-ylpropyl N-[3-[(6-methyl-2-oxo-1,3-benzoxazol-3-yl)methyl]phenyl]carbamate.
Molecular Properties
| Compound Name | 3-morpholin-4-ylpropyl N-[3-[(6-methyl-2-oxo-1,3-benzoxazol-3-yl)methyl]phenyl]carbamate |
| PubChem CID | 127031937 |
| Molecular Formula | C23H27N3O5 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | 3-morpholin-4-ylpropyl N-[3-[(6-methyl-2-oxo-1,3-benzoxazol-3-yl)methyl]phenyl]carbamate |
| SMILES | Cc1ccc2c(c1)oc(=O)n2Cc1cccc(NC(=O)OCCCN2CCOCC2)c1 |
| InChI | InChI=1S/C23H27N3O5/c1-17-6-7-20-21(14-17)31-23(28)26(20)16-18-4-2-5-19(15-18)24-22(27)30-11-3-8-25-9-12-29-13-10-25/h2,4-7,14-15H,3,8-13,16H2,1H3,(H,24,27) |
| InChIKey | LVQSINHNFWLTJU-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-morpholin-4-ylpropyl N-[3-[(6-methyl-2-oxo-1,3-benzoxazol-3-yl)methyl]phenyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-morpholin-4-ylpropyl N-[3-[(6-methyl-2-oxo-1,3-benzoxazol-3-yl)methyl]phenyl]carbamate?
The IUPAC name of 3-morpholin-4-ylpropyl N-[3-[(6-methyl-2-oxo-1,3-benzoxazol-3-yl)methyl]phenyl]carbamate (CID 127031937) is 3-morpholin-4-ylpropyl N-[3-[(6-methyl-2-oxo-1,3-benzoxazol-3-yl)methyl]phenyl]carbamate.
What is the SMILES notation for 3-morpholin-4-ylpropyl N-[3-[(6-methyl-2-oxo-1,3-benzoxazol-3-yl)methyl]phenyl]carbamate?
The canonical SMILES for 3-morpholin-4-ylpropyl N-[3-[(6-methyl-2-oxo-1,3-benzoxazol-3-yl)methyl]phenyl]carbamate is Cc1ccc2c(c1)oc(=O)n2Cc1cccc(NC(=O)OCCCN2CCOCC2)c1.
What is the InChIKey of 3-morpholin-4-ylpropyl N-[3-[(6-methyl-2-oxo-1,3-benzoxazol-3-yl)methyl]phenyl]carbamate?
The InChIKey is LVQSINHNFWLTJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H27N3O5/c1-17-6-7-20-21(14-17)31-23(28)26(20)16-18-4-2-5-19(15-18)24-22(27)30-11-3-8-25-9-12-29-13-10-25/h2,4-7,14-15H,3,8-13,16H2,1H3,(H,24,27).
What are the key properties of 3-morpholin-4-ylpropyl N-[3-[(6-methyl-2-oxo-1,3-benzoxazol-3-yl)methyl]phenyl]carbamate?
3-morpholin-4-ylpropyl N-[3-[(6-methyl-2-oxo-1,3-benzoxazol-3-yl)methyl]phenyl]carbamate has a molecular weight of 425.49 g/mol, XLogP of 3.22, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-morpholin-4-ylpropyl N-[3-[(6-methyl-2-oxo-1,3-benzoxazol-3-yl)methyl]phenyl]carbamate is sourced from PubChem (CID 127031937), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).