C28H24N4O4S — CID 127031938
6-methyl-4-(4-methylphenyl)-N-[4-[(E)-3-(3-nitrophenyl)prop-2-enoyl]phenyl]-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxamide (PubChem CID 127031938) has the molecular formula C28H24N4O4S and a molecular weight of 512.59 g/mol. Its IUPAC name is 6-methyl-4-(4-methylphenyl)-N-[4-[(E)-3-(3-nitrophenyl)prop-2-enoyl]phenyl]-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxamide.
| Compound Name | 6-methyl-4-(4-methylphenyl)-N-[4-[(E)-3-(3-nitrophenyl)prop-2-enoyl]phenyl]-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 127031938 |
| Molecular Formula | C28H24N4O4S |
| Molecular Weight | 512.59 g/mol |
| Exact Mass | 512.15 |
| IUPAC Name | 6-methyl-4-(4-methylphenyl)-N-[4-[(E)-3-(3-nitrophenyl)prop-2-enoyl]phenyl]-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxamide |
| SMILES | CC1=C(C(=O)Nc2ccc(C(=O)/C=C/c3cccc([N+](=O)[O-])c3)cc2)C(c2ccc(C)cc2)NC(=S)N1 |
| InChI | InChI=1S/C28H24N4O4S/c1-17-6-9-21(10-7-17)26-25(18(2)29-28(37)31-26)27(34)30-22-13-11-20(12-14-22)24(33)15-8-19-4-3-5-23(16-19)32(35)36/h3-16,26H,1-2H3,(H,30,34)(H2,29,31,37)/b15-8+ |
| InChIKey | QKYPLKRTLUWZDQ-OVCLIPMQSA-N |
| XLogP | 5.23 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.59 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|