About 6-[(E)-2-(2,4-difluorophenyl)-2-phenylethenyl]-4H-1,4-benzoxazin-3-one
6-[(E)-2-(2,4-difluorophenyl)-2-phenylethenyl]-4H-1,4-benzoxazin-3-one (PubChem CID 127032033) has the molecular formula C22H15F2NO2
and a molecular weight of 363.36 g/mol. Its IUPAC name is 6-[(E)-2-(2,4-difluorophenyl)-2-phenylethenyl]-4H-1,4-benzoxazin-3-one.
Molecular Properties
| Compound Name | 6-[(E)-2-(2,4-difluorophenyl)-2-phenylethenyl]-4H-1,4-benzoxazin-3-one |
| PubChem CID | 127032033 |
| Molecular Formula | C22H15F2NO2 |
| Molecular Weight | 363.36 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | 6-[(E)-2-(2,4-difluorophenyl)-2-phenylethenyl]-4H-1,4-benzoxazin-3-one |
| SMILES | O=C1COc2ccc(/C=C(\c3ccccc3)c3ccc(F)cc3F)cc2N1 |
| InChI | InChI=1S/C22H15F2NO2/c23-16-7-8-17(19(24)12-16)18(15-4-2-1-3-5-15)10-14-6-9-21-20(11-14)25-22(26)13-27-21/h1-12H,13H2,(H,25,26)/b18-10+ |
| InChIKey | DYAWCTLGJUXTGK-VCHYOVAHSA-N |
| XLogP | 4.88 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.36 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 6-[(E)-2-(2,4-difluorophenyl)-2-phenylethenyl]-4H-1,4-benzoxazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(E)-2-(2,4-difluorophenyl)-2-phenylethenyl]-4H-1,4-benzoxazin-3-one?
The IUPAC name of 6-[(E)-2-(2,4-difluorophenyl)-2-phenylethenyl]-4H-1,4-benzoxazin-3-one (CID 127032033) is 6-[(E)-2-(2,4-difluorophenyl)-2-phenylethenyl]-4H-1,4-benzoxazin-3-one.
What is the SMILES notation for 6-[(E)-2-(2,4-difluorophenyl)-2-phenylethenyl]-4H-1,4-benzoxazin-3-one?
The canonical SMILES for 6-[(E)-2-(2,4-difluorophenyl)-2-phenylethenyl]-4H-1,4-benzoxazin-3-one is O=C1COc2ccc(/C=C(\c3ccccc3)c3ccc(F)cc3F)cc2N1.
What is the InChIKey of 6-[(E)-2-(2,4-difluorophenyl)-2-phenylethenyl]-4H-1,4-benzoxazin-3-one?
The InChIKey is DYAWCTLGJUXTGK-VCHYOVAHSA-N. The full InChI is InChI=1S/C22H15F2NO2/c23-16-7-8-17(19(24)12-16)18(15-4-2-1-3-5-15)10-14-6-9-21-20(11-14)25-22(26)13-27-21/h1-12H,13H2,(H,25,26)/b18-10+.
What are the key properties of 6-[(E)-2-(2,4-difluorophenyl)-2-phenylethenyl]-4H-1,4-benzoxazin-3-one?
6-[(E)-2-(2,4-difluorophenyl)-2-phenylethenyl]-4H-1,4-benzoxazin-3-one has a molecular weight of 363.36 g/mol, XLogP of 4.88, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(E)-2-(2,4-difluorophenyl)-2-phenylethenyl]-4H-1,4-benzoxazin-3-one is sourced from PubChem (CID 127032033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).