About 6-[(2,4-difluoro-N-methylanilino)methyl]-4H-1,4-benzoxazin-3-one
6-[(2,4-difluoro-N-methylanilino)methyl]-4H-1,4-benzoxazin-3-one (PubChem CID 127032034) has the molecular formula C16H14F2N2O2
and a molecular weight of 304.30 g/mol. Its IUPAC name is 6-[(2,4-difluoro-N-methylanilino)methyl]-4H-1,4-benzoxazin-3-one.
Molecular Properties
| Compound Name | 6-[(2,4-difluoro-N-methylanilino)methyl]-4H-1,4-benzoxazin-3-one |
| PubChem CID | 127032034 |
| Molecular Formula | C16H14F2N2O2 |
| Molecular Weight | 304.30 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | 6-[(2,4-difluoro-N-methylanilino)methyl]-4H-1,4-benzoxazin-3-one |
| SMILES | CN(Cc1ccc2c(c1)NC(=O)CO2)c1ccc(F)cc1F |
| InChI | InChI=1S/C16H14F2N2O2/c1-20(14-4-3-11(17)7-12(14)18)8-10-2-5-15-13(6-10)19-16(21)9-22-15/h2-7H,8-9H2,1H3,(H,19,21) |
| InChIKey | OTEQPCXYKUYMJO-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.30 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-[(2,4-difluoro-N-methylanilino)methyl]-4H-1,4-benzoxazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(2,4-difluoro-N-methylanilino)methyl]-4H-1,4-benzoxazin-3-one?
The IUPAC name of 6-[(2,4-difluoro-N-methylanilino)methyl]-4H-1,4-benzoxazin-3-one (CID 127032034) is 6-[(2,4-difluoro-N-methylanilino)methyl]-4H-1,4-benzoxazin-3-one.
What is the SMILES notation for 6-[(2,4-difluoro-N-methylanilino)methyl]-4H-1,4-benzoxazin-3-one?
The canonical SMILES for 6-[(2,4-difluoro-N-methylanilino)methyl]-4H-1,4-benzoxazin-3-one is CN(Cc1ccc2c(c1)NC(=O)CO2)c1ccc(F)cc1F.
What is the InChIKey of 6-[(2,4-difluoro-N-methylanilino)methyl]-4H-1,4-benzoxazin-3-one?
The InChIKey is OTEQPCXYKUYMJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14F2N2O2/c1-20(14-4-3-11(17)7-12(14)18)8-10-2-5-15-13(6-10)19-16(21)9-22-15/h2-7H,8-9H2,1H3,(H,19,21).
What are the key properties of 6-[(2,4-difluoro-N-methylanilino)methyl]-4H-1,4-benzoxazin-3-one?
6-[(2,4-difluoro-N-methylanilino)methyl]-4H-1,4-benzoxazin-3-one has a molecular weight of 304.30 g/mol, XLogP of 2.93, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(2,4-difluoro-N-methylanilino)methyl]-4H-1,4-benzoxazin-3-one is sourced from PubChem (CID 127032034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).