About (2S)-4-(imidazo[1,2-a]pyridin-2-ylmethyl)-2-(phenoxymethyl)morpholine
(2S)-4-(imidazo[1,2-a]pyridin-2-ylmethyl)-2-(phenoxymethyl)morpholine (PubChem CID 127032082) has the molecular formula C19H21N3O2
and a molecular weight of 323.40 g/mol. Its IUPAC name is (2S)-4-(imidazo[1,2-a]pyridin-2-ylmethyl)-2-(phenoxymethyl)morpholine.
Molecular Properties
| Compound Name | (2S)-4-(imidazo[1,2-a]pyridin-2-ylmethyl)-2-(phenoxymethyl)morpholine |
| PubChem CID | 127032082 |
| Molecular Formula | C19H21N3O2 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | (2S)-4-(imidazo[1,2-a]pyridin-2-ylmethyl)-2-(phenoxymethyl)morpholine |
| SMILES | c1ccc(OC[C@@H]2CN(Cc3cn4ccccc4n3)CCO2)cc1 |
| InChI | InChI=1S/C19H21N3O2/c1-2-6-17(7-3-1)24-15-18-14-21(10-11-23-18)12-16-13-22-9-5-4-8-19(22)20-16/h1-9,13,18H,10-12,14-15H2/t18-/m0/s1 |
| InChIKey | VFRYJHHXNGOGDM-SFHVURJKSA-N |
| XLogP | 2.61 |
| TPSA | 39.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2S)-4-(imidazo[1,2-a]pyridin-2-ylmethyl)-2-(phenoxymethyl)morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-4-(imidazo[1,2-a]pyridin-2-ylmethyl)-2-(phenoxymethyl)morpholine?
The IUPAC name of (2S)-4-(imidazo[1,2-a]pyridin-2-ylmethyl)-2-(phenoxymethyl)morpholine (CID 127032082) is (2S)-4-(imidazo[1,2-a]pyridin-2-ylmethyl)-2-(phenoxymethyl)morpholine.
What is the SMILES notation for (2S)-4-(imidazo[1,2-a]pyridin-2-ylmethyl)-2-(phenoxymethyl)morpholine?
The canonical SMILES for (2S)-4-(imidazo[1,2-a]pyridin-2-ylmethyl)-2-(phenoxymethyl)morpholine is c1ccc(OC[C@@H]2CN(Cc3cn4ccccc4n3)CCO2)cc1.
What is the InChIKey of (2S)-4-(imidazo[1,2-a]pyridin-2-ylmethyl)-2-(phenoxymethyl)morpholine?
The InChIKey is VFRYJHHXNGOGDM-SFHVURJKSA-N. The full InChI is InChI=1S/C19H21N3O2/c1-2-6-17(7-3-1)24-15-18-14-21(10-11-23-18)12-16-13-22-9-5-4-8-19(22)20-16/h1-9,13,18H,10-12,14-15H2/t18-/m0/s1.
What are the key properties of (2S)-4-(imidazo[1,2-a]pyridin-2-ylmethyl)-2-(phenoxymethyl)morpholine?
(2S)-4-(imidazo[1,2-a]pyridin-2-ylmethyl)-2-(phenoxymethyl)morpholine has a molecular weight of 323.40 g/mol, XLogP of 2.61, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-4-(imidazo[1,2-a]pyridin-2-ylmethyl)-2-(phenoxymethyl)morpholine is sourced from PubChem (CID 127032082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).