C14H14N2O4S — CID 127032288
(10S,11R,12S,13R)-12,13-dihydroxy-9-thia-1,15-diazatetracyclo[8.7.0.03,8.011,15]heptadeca-3,5,7-triene-2,16-dione (PubChem CID 127032288) has the molecular formula C14H14N2O4S and a molecular weight of 306.34 g/mol. Its IUPAC name is (10S,11R,12S,13R)-12,13-dihydroxy-9-thia-1,15-diazatetracyclo[8.7.0.03,8.011,15]heptadeca-3,5,7-triene-2,16-dione.
| Compound Name | (10S,11R,12S,13R)-12,13-dihydroxy-9-thia-1,15-diazatetracyclo[8.7.0.03,8.011,15]heptadeca-3,5,7-triene-2,16-dione |
|---|---|
| PubChem CID | 127032288 |
| Molecular Formula | C14H14N2O4S |
| Molecular Weight | 306.34 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | (10S,11R,12S,13R)-12,13-dihydroxy-9-thia-1,15-diazatetracyclo[8.7.0.03,8.011,15]heptadeca-3,5,7-triene-2,16-dione |
| SMILES | O=C1CN2C(=O)c3ccccc3S[C@H]2[C@H]2[C@H](O)[C@H](O)CN12 |
| InChI | InChI=1S/C14H14N2O4S/c17-8-5-15-10(18)6-16-13(20)7-3-1-2-4-9(7)21-14(16)11(15)12(8)19/h1-4,8,11-12,14,17,19H,5-6H2/t8-,11-,12-,14+/m1/s1 |
| InChIKey | OKXQJMHVDGGCLB-PBFTVQBMSA-N |
| XLogP | -0.49 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.34 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |