C25H24N2O5 — CID 127032375
(4S,5S,6R)-6-(4-hydroxyphenyl)-1-[(3-methoxyphenyl)methyl]-5-nitro-4-phenylpiperidin-2-one (PubChem CID 127032375) has the molecular formula C25H24N2O5 and a molecular weight of 432.48 g/mol. Its IUPAC name is (4S,5S,6R)-6-(4-hydroxyphenyl)-1-[(3-methoxyphenyl)methyl]-5-nitro-4-phenylpiperidin-2-one.
| Compound Name | (4S,5S,6R)-6-(4-hydroxyphenyl)-1-[(3-methoxyphenyl)methyl]-5-nitro-4-phenylpiperidin-2-one |
|---|---|
| PubChem CID | 127032375 |
| Molecular Formula | C25H24N2O5 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | (4S,5S,6R)-6-(4-hydroxyphenyl)-1-[(3-methoxyphenyl)methyl]-5-nitro-4-phenylpiperidin-2-one |
| SMILES | COc1cccc(CN2C(=O)C[C@@H](c3ccccc3)[C@H]([N+](=O)[O-])C2c2ccc(O)cc2)c1 |
| InChI | InChI=1S/C25H24N2O5/c1-32-21-9-5-6-17(14-21)16-26-23(29)15-22(18-7-3-2-4-8-18)25(27(30)31)24(26)19-10-12-20(28)13-11-19/h2-14,22,24-25,28H,15-16H2,1H3/t22-,24?,25-/m0/s1 |
| InChIKey | ITUONADLLZGHPF-HSPGVUBUSA-N |
| XLogP | 4.30 |
| TPSA | 92.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|