C14H12ClN5O2 — CID 127032395
2-[4-amino-3-(4-chlorophenyl)-1H-pyrazole-5-carbonyl]-5-methyl-4H-pyrazol-3-one (PubChem CID 127032395) has the molecular formula C14H12ClN5O2 and a molecular weight of 317.74 g/mol. Its IUPAC name is 2-[4-amino-3-(4-chlorophenyl)-1H-pyrazole-5-carbonyl]-5-methyl-4H-pyrazol-3-one.
| Compound Name | 2-[4-amino-3-(4-chlorophenyl)-1H-pyrazole-5-carbonyl]-5-methyl-4H-pyrazol-3-one |
|---|---|
| PubChem CID | 127032395 |
| Molecular Formula | C14H12ClN5O2 |
| Molecular Weight | 317.74 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | 2-[4-amino-3-(4-chlorophenyl)-1H-pyrazole-5-carbonyl]-5-methyl-4H-pyrazol-3-one |
| SMILES | CC1=NN(C(=O)c2[nH]nc(-c3ccc(Cl)cc3)c2N)C(=O)C1 |
| InChI | InChI=1S/C14H12ClN5O2/c1-7-6-10(21)20(19-7)14(22)13-11(16)12(17-18-13)8-2-4-9(15)5-3-8/h2-5H,6,16H2,1H3,(H,17,18) |
| InChIKey | ICGJETDOFKKRRW-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 104.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.74 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|