C25H44O5 — CID 127032427
methyl (2S)-2-[(3R,6S)-6-[(E)-6-(2-hydroxy-1,2,6-trimethylcyclohexyl)-4-methylhex-3-enyl]-6-methyldioxan-3-yl]propanoate (PubChem CID 127032427) has the molecular formula C25H44O5 and a molecular weight of 424.62 g/mol. Its IUPAC name is methyl (2S)-2-[(3R,6S)-6-[(E)-6-(2-hydroxy-1,2,6-trimethylcyclohexyl)-4-methylhex-3-enyl]-6-methyldioxan-3-yl]propanoate.
| Compound Name | methyl (2S)-2-[(3R,6S)-6-[(E)-6-(2-hydroxy-1,2,6-trimethylcyclohexyl)-4-methylhex-3-enyl]-6-methyldioxan-3-yl]propanoate |
|---|---|
| PubChem CID | 127032427 |
| Molecular Formula | C25H44O5 |
| Molecular Weight | 424.62 g/mol |
| Exact Mass | 424.32 |
| IUPAC Name | methyl (2S)-2-[(3R,6S)-6-[(E)-6-(2-hydroxy-1,2,6-trimethylcyclohexyl)-4-methylhex-3-enyl]-6-methyldioxan-3-yl]propanoate |
| SMILES | COC(=O)[C@@H](C)[C@H]1CC[C@](C)(CC/C=C(\C)CCC2(C)C(C)CCCC2(C)O)OO1 |
| InChI | InChI=1S/C25H44O5/c1-18(12-17-24(5)19(2)11-9-15-25(24,6)27)10-8-14-23(4)16-13-21(29-30-23)20(3)22(26)28-7/h10,19-21,27H,8-9,11-17H2,1-7H3/b18-10+/t19?,20-,21+,23-,24?,25?/m0/s1 |
| InChIKey | PYRDXCUKHATXIK-ZXTPLGTPSA-N |
| XLogP | 5.75 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.62 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|