C23H24N4OS — CID 127032659
(1R,3R)-1-(oxan-4-yl)-3-(5-thiophen-3-yl-1H-imidazol-2-yl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole (PubChem CID 127032659) has the molecular formula C23H24N4OS and a molecular weight of 404.54 g/mol. Its IUPAC name is (1R,3R)-1-(oxan-4-yl)-3-(5-thiophen-3-yl-1H-imidazol-2-yl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole.
| Compound Name | (1R,3R)-1-(oxan-4-yl)-3-(5-thiophen-3-yl-1H-imidazol-2-yl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole |
|---|---|
| PubChem CID | 127032659 |
| Molecular Formula | C23H24N4OS |
| Molecular Weight | 404.54 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | (1R,3R)-1-(oxan-4-yl)-3-(5-thiophen-3-yl-1H-imidazol-2-yl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole |
| SMILES | c1ccc2c3c([nH]c2c1)[C@@H](C1CCOCC1)N[C@@H](c1ncc(-c2ccsc2)[nH]1)C3 |
| InChI | InChI=1S/C23H24N4OS/c1-2-4-18-16(3-1)17-11-19(23-24-12-20(27-23)15-7-10-29-13-15)26-21(22(17)25-18)14-5-8-28-9-6-14/h1-4,7,10,12-14,19,21,25-26H,5-6,8-9,11H2,(H,24,27)/t19-,21-/m1/s1 |
| InChIKey | GJXBTFZLJZMFBR-TZIWHRDSSA-N |
| XLogP | 4.97 |
| TPSA | 65.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.54 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|