C23H31N6O9P — CID 127032685
ethyl (2S)-2-[[[(2R,3R,4R,5R)-5-(6-amino-2-methoxypurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 127032685) has the molecular formula C23H31N6O9P and a molecular weight of 566.51 g/mol. Its IUPAC name is ethyl (2S)-2-[[[(2R,3R,4R,5R)-5-(6-amino-2-methoxypurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | ethyl (2S)-2-[[[(2R,3R,4R,5R)-5-(6-amino-2-methoxypurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 127032685 |
| Molecular Formula | C23H31N6O9P |
| Molecular Weight | 566.51 g/mol |
| Exact Mass | 566.19 |
| IUPAC Name | ethyl (2S)-2-[[[(2R,3R,4R,5R)-5-(6-amino-2-methoxypurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CCOC(=O)[C@H](C)NP(=O)(OC[C@H]1O[C@@H](n2cnc3c(N)nc(OC)nc32)[C@](C)(O)[C@@H]1O)Oc1ccccc1 |
| InChI | InChI=1S/C23H31N6O9P/c1-5-35-20(31)13(2)28-39(33,38-14-9-7-6-8-10-14)36-11-15-17(30)23(3,32)21(37-15)29-12-25-16-18(24)26-22(34-4)27-19(16)29/h6-10,12-13,15,17,21,30,32H,5,11H2,1-4H3,(H,28,33)(H2,24,26,27)/t13-,15+,17+,21+,23+,39?/m0/s1 |
| InChIKey | WOVGDPYAPODCOT-DPVNHMNCSA-N |
| XLogP | 1.17 |
| TPSA | 202.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.51 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|