C22H30N4O — CID 127032696
4-[3-(4-methylpiperazin-1-yl)propoxy]-2-phenyl-5,6,7,8-tetrahydroquinazoline (PubChem CID 127032696) has the molecular formula C22H30N4O and a molecular weight of 366.51 g/mol. Its IUPAC name is 4-[3-(4-methylpiperazin-1-yl)propoxy]-2-phenyl-5,6,7,8-tetrahydroquinazoline.
| Compound Name | 4-[3-(4-methylpiperazin-1-yl)propoxy]-2-phenyl-5,6,7,8-tetrahydroquinazoline |
|---|---|
| PubChem CID | 127032696 |
| Molecular Formula | C22H30N4O |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.24 |
| IUPAC Name | 4-[3-(4-methylpiperazin-1-yl)propoxy]-2-phenyl-5,6,7,8-tetrahydroquinazoline |
| SMILES | CN1CCN(CCCOc2nc(-c3ccccc3)nc3c2CCCC3)CC1 |
| InChI | InChI=1S/C22H30N4O/c1-25-13-15-26(16-14-25)12-7-17-27-22-19-10-5-6-11-20(19)23-21(24-22)18-8-3-2-4-9-18/h2-4,8-9H,5-7,10-17H2,1H3 |
| InChIKey | SXGWUBXJWAUYRH-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 41.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|