C38H53N3O — CID 127032735
(1R,2S,5S,10S,14R,15R,23R)-N-benzyl-1,2,8,8,15,22,22-heptamethyl-19,20-diazahexacyclo[12.11.0.02,11.05,10.015,23.017,21]pentacosa-11,17(21),18-triene-5-carboxamide (PubChem CID 127032735) has the molecular formula C38H53N3O and a molecular weight of 567.86 g/mol. Its IUPAC name is (1R,2S,5S,10S,14R,15R,23R)-N-benzyl-1,2,8,8,15,22,22-heptamethyl-19,20-diazahexacyclo[12.11.0.02,11.05,10.015,23.017,21]pentacosa-11,17(21),18-triene-5-carboxamide.
| Compound Name | (1R,2S,5S,10S,14R,15R,23R)-N-benzyl-1,2,8,8,15,22,22-heptamethyl-19,20-diazahexacyclo[12.11.0.02,11.05,10.015,23.017,21]pentacosa-11,17(21),18-triene-5-carboxamide |
|---|---|
| PubChem CID | 127032735 |
| Molecular Formula | C38H53N3O |
| Molecular Weight | 567.86 g/mol |
| Exact Mass | 567.42 |
| IUPAC Name | (1R,2S,5S,10S,14R,15R,23R)-N-benzyl-1,2,8,8,15,22,22-heptamethyl-19,20-diazahexacyclo[12.11.0.02,11.05,10.015,23.017,21]pentacosa-11,17(21),18-triene-5-carboxamide |
| SMILES | CC1(C)CC[C@]2(C(=O)NCc3ccccc3)CC[C@]3(C)C(=CC[C@@H]4[C@@]5(C)Cc6cn[nH]c6C(C)(C)[C@@H]5CC[C@]43C)[C@@H]2C1 |
| InChI | InChI=1S/C38H53N3O/c1-33(2)17-19-38(32(42)39-23-25-11-9-8-10-12-25)20-18-36(6)27(28(38)22-33)13-14-30-35(5)21-26-24-40-41-31(26)34(3,4)29(35)15-16-37(30,36)7/h8-13,24,28-30H,14-23H2,1-7H3,(H,39,42)(H,40,41)/t28-,29-,30+,35-,36+,37+,38-/m0/s1 |
| InChIKey | DTHSOQMYBPWORB-RXLVGJJOSA-N |
| XLogP | 8.54 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.86 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|