About 1-[3-[(2-phenyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)oxy]propyl]piperidin-4-one
1-[3-[(2-phenyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)oxy]propyl]piperidin-4-one (PubChem CID 127032801) has the molecular formula C21H25N3O2
and a molecular weight of 351.45 g/mol. Its IUPAC name is 1-[3-[(2-phenyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)oxy]propyl]piperidin-4-one.
Molecular Properties
| Compound Name | 1-[3-[(2-phenyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)oxy]propyl]piperidin-4-one |
| PubChem CID | 127032801 |
| Molecular Formula | C21H25N3O2 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | 1-[3-[(2-phenyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)oxy]propyl]piperidin-4-one |
| SMILES | O=C1CCN(CCCOc2nc(-c3ccccc3)nc3c2CCC3)CC1 |
| InChI | InChI=1S/C21H25N3O2/c25-17-10-13-24(14-11-17)12-5-15-26-21-18-8-4-9-19(18)22-20(23-21)16-6-2-1-3-7-16/h1-3,6-7H,4-5,8-15H2 |
| InChIKey | DYDIEYCYPAHISG-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-[3-[(2-phenyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)oxy]propyl]piperidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-[(2-phenyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)oxy]propyl]piperidin-4-one?
The IUPAC name of 1-[3-[(2-phenyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)oxy]propyl]piperidin-4-one (CID 127032801) is 1-[3-[(2-phenyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)oxy]propyl]piperidin-4-one.
What is the SMILES notation for 1-[3-[(2-phenyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)oxy]propyl]piperidin-4-one?
The canonical SMILES for 1-[3-[(2-phenyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)oxy]propyl]piperidin-4-one is O=C1CCN(CCCOc2nc(-c3ccccc3)nc3c2CCC3)CC1.
What is the InChIKey of 1-[3-[(2-phenyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)oxy]propyl]piperidin-4-one?
The InChIKey is DYDIEYCYPAHISG-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H25N3O2/c25-17-10-13-24(14-11-17)12-5-15-26-21-18-8-4-9-19(18)22-20(23-21)16-6-2-1-3-7-16/h1-3,6-7H,4-5,8-15H2.
What are the key properties of 1-[3-[(2-phenyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)oxy]propyl]piperidin-4-one?
1-[3-[(2-phenyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)oxy]propyl]piperidin-4-one has a molecular weight of 351.45 g/mol, XLogP of 3.07, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-[(2-phenyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)oxy]propyl]piperidin-4-one is sourced from PubChem (CID 127032801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).