C15H16N2O4S — CID 127032858
(10S,11R,12S,13R,17R)-12,13-dihydroxy-17-methyl-9-thia-1,15-diazatetracyclo[8.7.0.03,8.011,15]heptadeca-3,5,7-triene-2,16-dione (PubChem CID 127032858) has the molecular formula C15H16N2O4S and a molecular weight of 320.37 g/mol. Its IUPAC name is (10S,11R,12S,13R,17R)-12,13-dihydroxy-17-methyl-9-thia-1,15-diazatetracyclo[8.7.0.03,8.011,15]heptadeca-3,5,7-triene-2,16-dione.
| Compound Name | (10S,11R,12S,13R,17R)-12,13-dihydroxy-17-methyl-9-thia-1,15-diazatetracyclo[8.7.0.03,8.011,15]heptadeca-3,5,7-triene-2,16-dione |
|---|---|
| PubChem CID | 127032858 |
| Molecular Formula | C15H16N2O4S |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | (10S,11R,12S,13R,17R)-12,13-dihydroxy-17-methyl-9-thia-1,15-diazatetracyclo[8.7.0.03,8.011,15]heptadeca-3,5,7-triene-2,16-dione |
| SMILES | C[C@@H]1C(=O)N2C[C@@H](O)[C@@H](O)[C@@H]2[C@@H]2Sc3ccccc3C(=O)N12 |
| InChI | InChI=1S/C15H16N2O4S/c1-7-13(20)16-6-9(18)12(19)11(16)15-17(7)14(21)8-4-2-3-5-10(8)22-15/h2-5,7,9,11-12,15,18-19H,6H2,1H3/t7-,9-,11-,12-,15+/m1/s1 |
| InChIKey | GOWJZKFOGIEYQM-OAAHGVCESA-N |
| XLogP | -0.10 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |