C25H31N5O3 — CID 127032986
N-(1-adamantyl)-2-(furan-2-yl)-7-oxo-4-pentyl-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 127032986) has the molecular formula C25H31N5O3 and a molecular weight of 449.56 g/mol. Its IUPAC name is N-(1-adamantyl)-2-(furan-2-yl)-7-oxo-4-pentyl-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | N-(1-adamantyl)-2-(furan-2-yl)-7-oxo-4-pentyl-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 127032986 |
| Molecular Formula | C25H31N5O3 |
| Molecular Weight | 449.56 g/mol |
| Exact Mass | 449.24 |
| IUPAC Name | N-(1-adamantyl)-2-(furan-2-yl)-7-oxo-4-pentyl-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | CCCCCn1cc(C(=O)NC23CC4CC(CC(C4)C2)C3)c(=O)n2nc(-c3ccco3)nc12 |
| InChI | InChI=1S/C25H31N5O3/c1-2-3-4-7-29-15-19(23(32)30-24(29)26-21(28-30)20-6-5-8-33-20)22(31)27-25-12-16-9-17(13-25)11-18(10-16)14-25/h5-6,8,15-18H,2-4,7,9-14H2,1H3,(H,27,31) |
| InChIKey | CHHUFFBCNAMVKC-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 94.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.56 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|