C16H16Cl2N2O — CID 127033012
2-(2,6-dichlorophenyl)-1,3-dimethyl-2,4-dihydroquinazolin-6-ol (PubChem CID 127033012) has the molecular formula C16H16Cl2N2O and a molecular weight of 323.22 g/mol. Its IUPAC name is 2-(2,6-dichlorophenyl)-1,3-dimethyl-2,4-dihydroquinazolin-6-ol.
| Compound Name | 2-(2,6-dichlorophenyl)-1,3-dimethyl-2,4-dihydroquinazolin-6-ol |
|---|---|
| PubChem CID | 127033012 |
| Molecular Formula | C16H16Cl2N2O |
| Molecular Weight | 323.22 g/mol |
| Exact Mass | 322.06 |
| IUPAC Name | 2-(2,6-dichlorophenyl)-1,3-dimethyl-2,4-dihydroquinazolin-6-ol |
| SMILES | CN1Cc2cc(O)ccc2N(C)C1c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C16H16Cl2N2O/c1-19-9-10-8-11(21)6-7-14(10)20(2)16(19)15-12(17)4-3-5-13(15)18/h3-8,16,21H,9H2,1-2H3 |
| InChIKey | BMOGOJGTAVLCMW-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.22 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |