About N,N-diethyl-3-[(2-phenyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)oxy]propan-1-amine
N,N-diethyl-3-[(2-phenyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)oxy]propan-1-amine (PubChem CID 127033036) has the molecular formula C20H27N3O
and a molecular weight of 325.46 g/mol. Its IUPAC name is N,N-diethyl-3-[(2-phenyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)oxy]propan-1-amine.
Molecular Properties
| Compound Name | N,N-diethyl-3-[(2-phenyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)oxy]propan-1-amine |
| PubChem CID | 127033036 |
| Molecular Formula | C20H27N3O |
| Molecular Weight | 325.46 g/mol |
| Exact Mass | 325.22 |
| IUPAC Name | N,N-diethyl-3-[(2-phenyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)oxy]propan-1-amine |
| SMILES | CCN(CC)CCCOc1nc(-c2ccccc2)nc2c1CCC2 |
| InChI | InChI=1S/C20H27N3O/c1-3-23(4-2)14-9-15-24-20-17-12-8-13-18(17)21-19(22-20)16-10-6-5-7-11-16/h5-7,10-11H,3-4,8-9,12-15H2,1-2H3 |
| InChIKey | OSSARWRGUMJPJZ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.46 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N,N-diethyl-3-[(2-phenyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)oxy]propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethyl-3-[(2-phenyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)oxy]propan-1-amine?
The IUPAC name of N,N-diethyl-3-[(2-phenyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)oxy]propan-1-amine (CID 127033036) is N,N-diethyl-3-[(2-phenyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)oxy]propan-1-amine.
What is the SMILES notation for N,N-diethyl-3-[(2-phenyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)oxy]propan-1-amine?
The canonical SMILES for N,N-diethyl-3-[(2-phenyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)oxy]propan-1-amine is CCN(CC)CCCOc1nc(-c2ccccc2)nc2c1CCC2.
What is the InChIKey of N,N-diethyl-3-[(2-phenyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)oxy]propan-1-amine?
The InChIKey is OSSARWRGUMJPJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H27N3O/c1-3-23(4-2)14-9-15-24-20-17-12-8-13-18(17)21-19(22-20)16-10-6-5-7-11-16/h5-7,10-11H,3-4,8-9,12-15H2,1-2H3.
What are the key properties of N,N-diethyl-3-[(2-phenyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)oxy]propan-1-amine?
N,N-diethyl-3-[(2-phenyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)oxy]propan-1-amine has a molecular weight of 325.46 g/mol, XLogP of 3.74, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethyl-3-[(2-phenyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)oxy]propan-1-amine is sourced from PubChem (CID 127033036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).