C29H34Br2O7 — CID 127033126
(2E,6E)-2,6-bis[(2-bromo-3,4,5-trimethoxyphenyl)methylidene]-4-propan-2-ylcyclohexan-1-one (PubChem CID 127033126) has the molecular formula C29H34Br2O7 and a molecular weight of 654.39 g/mol. Its IUPAC name is (2E,6E)-2,6-bis[(2-bromo-3,4,5-trimethoxyphenyl)methylidene]-4-propan-2-ylcyclohexan-1-one.
| Compound Name | (2E,6E)-2,6-bis[(2-bromo-3,4,5-trimethoxyphenyl)methylidene]-4-propan-2-ylcyclohexan-1-one |
|---|---|
| PubChem CID | 127033126 |
| Molecular Formula | C29H34Br2O7 |
| Molecular Weight | 654.39 g/mol |
| Exact Mass | 652.07 |
| IUPAC Name | (2E,6E)-2,6-bis[(2-bromo-3,4,5-trimethoxyphenyl)methylidene]-4-propan-2-ylcyclohexan-1-one |
| SMILES | COc1cc(/C=C2\CC(C(C)C)C/C(=C\c3cc(OC)c(OC)c(OC)c3Br)C2=O)c(Br)c(OC)c1OC |
| InChI | InChI=1S/C29H34Br2O7/c1-15(2)16-9-19(11-17-13-21(33-3)26(35-5)28(37-7)23(17)30)25(32)20(10-16)12-18-14-22(34-4)27(36-6)29(38-8)24(18)31/h11-16H,9-10H2,1-8H3/b19-11+,20-12+ |
| InChIKey | NWAPNKNUYAVZOA-AYKLPDECSA-N |
| XLogP | 7.37 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.39 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|