C34H49FO5 — CID 127033154
[(1S,4S,5R,8R,9R,12R,13S,15R,16S,17R,18S,19R)-15-fluoro-11-formyl-4,5,9,12,18,19-hexamethyl-22-oxo-23-oxahexacyclo[14.5.2.01,17.04,16.05,13.08,12]tricos-10-en-9-yl]methyl butanoate (PubChem CID 127033154) has the molecular formula C34H49FO5 and a molecular weight of 556.76 g/mol. Its IUPAC name is [(1S,4S,5R,8R,9R,12R,13S,15R,16S,17R,18S,19R)-15-fluoro-11-formyl-4,5,9,12,18,19-hexamethyl-22-oxo-23-oxahexacyclo[14.5.2.01,17.04,16.05,13.08,12]tricos-10-en-9-yl]methyl butanoate.
| Compound Name | [(1S,4S,5R,8R,9R,12R,13S,15R,16S,17R,18S,19R)-15-fluoro-11-formyl-4,5,9,12,18,19-hexamethyl-22-oxo-23-oxahexacyclo[14.5.2.01,17.04,16.05,13.08,12]tricos-10-en-9-yl]methyl butanoate |
|---|---|
| PubChem CID | 127033154 |
| Molecular Formula | C34H49FO5 |
| Molecular Weight | 556.76 g/mol |
| Exact Mass | 556.36 |
| IUPAC Name | [(1S,4S,5R,8R,9R,12R,13S,15R,16S,17R,18S,19R)-15-fluoro-11-formyl-4,5,9,12,18,19-hexamethyl-22-oxo-23-oxahexacyclo[14.5.2.01,17.04,16.05,13.08,12]tricos-10-en-9-yl]methyl butanoate |
| SMILES | CCCC(=O)OC[C@]1(C)C=C(C=O)[C@@]2(C)[C@H]1CC[C@]1(C)[C@@H]2C[C@@H](F)[C@]23OC(=O)[C@@]4(CC[C@@H](C)[C@H](C)[C@H]42)CC[C@]31C |
| InChI | InChI=1S/C34H49FO5/c1-8-9-26(37)39-19-29(4)17-22(18-36)32(7)23(29)11-12-30(5)24(32)16-25(35)34-27-21(3)20(2)10-13-33(27,28(38)40-34)15-14-31(30,34)6/h17-18,20-21,23-25,27H,8-16,19H2,1-7H3/t20-,21+,23+,24+,25-,27-,29+,30-,31+,32+,33+,34+/m1/s1 |
| InChIKey | LLVADGWGMNRZTI-YWNGUQQISA-N |
| XLogP | 7.02 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.76 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|