C25H23N3O3S — CID 127033252
4-(1,3-oxazol-5-yl)-N-[[4-(4-phenyl-1,3-thiazol-2-yl)oxan-4-yl]methyl]benzamide (PubChem CID 127033252) has the molecular formula C25H23N3O3S and a molecular weight of 445.54 g/mol. Its IUPAC name is 4-(1,3-oxazol-5-yl)-N-[[4-(4-phenyl-1,3-thiazol-2-yl)oxan-4-yl]methyl]benzamide.
| Compound Name | 4-(1,3-oxazol-5-yl)-N-[[4-(4-phenyl-1,3-thiazol-2-yl)oxan-4-yl]methyl]benzamide |
|---|---|
| PubChem CID | 127033252 |
| Molecular Formula | C25H23N3O3S |
| Molecular Weight | 445.54 g/mol |
| Exact Mass | 445.15 |
| IUPAC Name | 4-(1,3-oxazol-5-yl)-N-[[4-(4-phenyl-1,3-thiazol-2-yl)oxan-4-yl]methyl]benzamide |
| SMILES | O=C(NCC1(c2nc(-c3ccccc3)cs2)CCOCC1)c1ccc(-c2cnco2)cc1 |
| InChI | InChI=1S/C25H23N3O3S/c29-23(20-8-6-19(7-9-20)22-14-26-17-31-22)27-16-25(10-12-30-13-11-25)24-28-21(15-32-24)18-4-2-1-3-5-18/h1-9,14-15,17H,10-13,16H2,(H,27,29) |
| InChIKey | FMKAUHQQULAXBH-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.54 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |