C15H19N5 — CID 127033447
N-(3,3-dimethylbutyl)-3,5,8,9-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,7,10,12-hexaen-6-amine (PubChem CID 127033447) has the molecular formula C15H19N5 and a molecular weight of 269.35 g/mol. Its IUPAC name is N-(3,3-dimethylbutyl)-3,5,8,9-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,7,10,12-hexaen-6-amine.
| Compound Name | N-(3,3-dimethylbutyl)-3,5,8,9-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,7,10,12-hexaen-6-amine |
|---|---|
| PubChem CID | 127033447 |
| Molecular Formula | C15H19N5 |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | N-(3,3-dimethylbutyl)-3,5,8,9-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,7,10,12-hexaen-6-amine |
| SMILES | CC(C)(C)CCNc1ncnc2c1nn1ccccc21 |
| InChI | InChI=1S/C15H19N5/c1-15(2,3)7-8-16-14-13-12(17-10-18-14)11-6-4-5-9-20(11)19-13/h4-6,9-10H,7-8H2,1-3H3,(H,16,17,18) |
| InChIKey | HHIMHZFKPVFWSS-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 55.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |