C15H17N5 — CID 127033449
N-cyclohexyl-3,5,8,9-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,7,10,12-hexaen-6-amine (PubChem CID 127033449) has the molecular formula C15H17N5 and a molecular weight of 267.34 g/mol. Its IUPAC name is N-cyclohexyl-3,5,8,9-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,7,10,12-hexaen-6-amine.
| Compound Name | N-cyclohexyl-3,5,8,9-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,7,10,12-hexaen-6-amine |
|---|---|
| PubChem CID | 127033449 |
| Molecular Formula | C15H17N5 |
| Molecular Weight | 267.34 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | N-cyclohexyl-3,5,8,9-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,7,10,12-hexaen-6-amine |
| SMILES | c1ccn2nc3c(NC4CCCCC4)ncnc3c2c1 |
| InChI | InChI=1S/C15H17N5/c1-2-6-11(7-3-1)18-15-14-13(16-10-17-15)12-8-4-5-9-20(12)19-14/h4-5,8-11H,1-3,6-7H2,(H,16,17,18) |
| InChIKey | ILGCWVIQXYCYSQ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 55.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.34 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |