C16H19N5 — CID 127033450
N-cycloheptyl-3,5,8,9-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,7,10,12-hexaen-6-amine (PubChem CID 127033450) has the molecular formula C16H19N5 and a molecular weight of 281.36 g/mol. Its IUPAC name is N-cycloheptyl-3,5,8,9-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,7,10,12-hexaen-6-amine.
| Compound Name | N-cycloheptyl-3,5,8,9-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,7,10,12-hexaen-6-amine |
|---|---|
| PubChem CID | 127033450 |
| Molecular Formula | C16H19N5 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | N-cycloheptyl-3,5,8,9-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,7,10,12-hexaen-6-amine |
| SMILES | c1ccn2nc3c(NC4CCCCCC4)ncnc3c2c1 |
| InChI | InChI=1S/C16H19N5/c1-2-4-8-12(7-3-1)19-16-15-14(17-11-18-16)13-9-5-6-10-21(13)20-15/h5-6,9-12H,1-4,7-8H2,(H,17,18,19) |
| InChIKey | JOBBNADSLAYKJJ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 55.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |