About [1-(3,5-dimethylphenyl)triazol-4-yl]methyl 1H-indole-2-carboxylate
[1-(3,5-dimethylphenyl)triazol-4-yl]methyl 1H-indole-2-carboxylate (PubChem CID 127033492) has the molecular formula C20H18N4O2
and a molecular weight of 346.39 g/mol. Its IUPAC name is [1-(3,5-dimethylphenyl)triazol-4-yl]methyl 1H-indole-2-carboxylate.
Molecular Properties
| Compound Name | [1-(3,5-dimethylphenyl)triazol-4-yl]methyl 1H-indole-2-carboxylate |
| PubChem CID | 127033492 |
| Molecular Formula | C20H18N4O2 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | [1-(3,5-dimethylphenyl)triazol-4-yl]methyl 1H-indole-2-carboxylate |
| SMILES | Cc1cc(C)cc(-n2cc(COC(=O)c3cc4ccccc4[nH]3)nn2)c1 |
| InChI | InChI=1S/C20H18N4O2/c1-13-7-14(2)9-17(8-13)24-11-16(22-23-24)12-26-20(25)19-10-15-5-3-4-6-18(15)21-19/h3-11,21H,12H2,1-2H3 |
| InChIKey | YUDFNWBHKMAIAV-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [1-(3,5-dimethylphenyl)triazol-4-yl]methyl 1H-indole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(3,5-dimethylphenyl)triazol-4-yl]methyl 1H-indole-2-carboxylate?
The IUPAC name of [1-(3,5-dimethylphenyl)triazol-4-yl]methyl 1H-indole-2-carboxylate (CID 127033492) is [1-(3,5-dimethylphenyl)triazol-4-yl]methyl 1H-indole-2-carboxylate.
What is the SMILES notation for [1-(3,5-dimethylphenyl)triazol-4-yl]methyl 1H-indole-2-carboxylate?
The canonical SMILES for [1-(3,5-dimethylphenyl)triazol-4-yl]methyl 1H-indole-2-carboxylate is Cc1cc(C)cc(-n2cc(COC(=O)c3cc4ccccc4[nH]3)nn2)c1.
What is the InChIKey of [1-(3,5-dimethylphenyl)triazol-4-yl]methyl 1H-indole-2-carboxylate?
The InChIKey is YUDFNWBHKMAIAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18N4O2/c1-13-7-14(2)9-17(8-13)24-11-16(22-23-24)12-26-20(25)19-10-15-5-3-4-6-18(15)21-19/h3-11,21H,12H2,1-2H3.
What are the key properties of [1-(3,5-dimethylphenyl)triazol-4-yl]methyl 1H-indole-2-carboxylate?
[1-(3,5-dimethylphenyl)triazol-4-yl]methyl 1H-indole-2-carboxylate has a molecular weight of 346.39 g/mol, XLogP of 3.72, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(3,5-dimethylphenyl)triazol-4-yl]methyl 1H-indole-2-carboxylate is sourced from PubChem (CID 127033492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).