About 2,4,6,8-tetrachloroquinazoline
2,4,6,8-tetrachloroquinazoline (PubChem CID 12703363) has the molecular formula C8H2Cl4N2
and a molecular weight of 267.93 g/mol. Its IUPAC name is 2,4,6,8-tetrachloroquinazoline.
Molecular Properties
| Compound Name | 2,4,6,8-tetrachloroquinazoline |
| PubChem CID | 12703363 |
| Molecular Formula | C8H2Cl4N2 |
| Molecular Weight | 267.93 g/mol |
| Exact Mass | 265.90 |
| IUPAC Name | 2,4,6,8-tetrachloroquinazoline |
| SMILES | Clc1cc(Cl)c2nc(Cl)nc(Cl)c2c1 |
| InChI | InChI=1S/C8H2Cl4N2/c9-3-1-4-6(5(10)2-3)13-8(12)14-7(4)11/h1-2H |
| InChIKey | GYUFSVVBAINEBI-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.93 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,4,6,8-tetrachloroquinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4,6,8-tetrachloroquinazoline?
The IUPAC name of 2,4,6,8-tetrachloroquinazoline (CID 12703363) is 2,4,6,8-tetrachloroquinazoline.
What is the SMILES notation for 2,4,6,8-tetrachloroquinazoline?
The canonical SMILES for 2,4,6,8-tetrachloroquinazoline is Clc1cc(Cl)c2nc(Cl)nc(Cl)c2c1.
What is the InChIKey of 2,4,6,8-tetrachloroquinazoline?
The InChIKey is GYUFSVVBAINEBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H2Cl4N2/c9-3-1-4-6(5(10)2-3)13-8(12)14-7(4)11/h1-2H.
What are the key properties of 2,4,6,8-tetrachloroquinazoline?
2,4,6,8-tetrachloroquinazoline has a molecular weight of 267.93 g/mol, XLogP of 4.24, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4,6,8-tetrachloroquinazoline is sourced from PubChem (CID 12703363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).