About 6,11-dimethylpyrido[4,3-b]carbazole
6,11-dimethylpyrido[4,3-b]carbazole (PubChem CID 127033765) has the molecular formula C17H14N2
and a molecular weight of 246.31 g/mol. Its IUPAC name is 6,11-dimethylpyrido[4,3-b]carbazole.
Molecular Properties
| Compound Name | 6,11-dimethylpyrido[4,3-b]carbazole |
| PubChem CID | 127033765 |
| Molecular Formula | C17H14N2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | 6,11-dimethylpyrido[4,3-b]carbazole |
| SMILES | Cc1c2cnccc2cc2c1c1ccccc1n2C |
| InChI | InChI=1S/C17H14N2/c1-11-14-10-18-8-7-12(14)9-16-17(11)13-5-3-4-6-15(13)19(16)2/h3-10H,1-2H3 |
| InChIKey | YNGQQZQBYFGKRE-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6,11-dimethylpyrido[4,3-b]carbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,11-dimethylpyrido[4,3-b]carbazole?
The IUPAC name of 6,11-dimethylpyrido[4,3-b]carbazole (CID 127033765) is 6,11-dimethylpyrido[4,3-b]carbazole.
What is the SMILES notation for 6,11-dimethylpyrido[4,3-b]carbazole?
The canonical SMILES for 6,11-dimethylpyrido[4,3-b]carbazole is Cc1c2cnccc2cc2c1c1ccccc1n2C.
What is the InChIKey of 6,11-dimethylpyrido[4,3-b]carbazole?
The InChIKey is YNGQQZQBYFGKRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14N2/c1-11-14-10-18-8-7-12(14)9-16-17(11)13-5-3-4-6-15(13)19(16)2/h3-10H,1-2H3.
What are the key properties of 6,11-dimethylpyrido[4,3-b]carbazole?
6,11-dimethylpyrido[4,3-b]carbazole has a molecular weight of 246.31 g/mol, XLogP of 4.19, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6,11-dimethylpyrido[4,3-b]carbazole is sourced from PubChem (CID 127033765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).