C19H23F3O3S — CID 127033802
[4-[(1E,3S)-3-ethenyl-3,7-dimethylocta-1,6-dienyl]phenyl] trifluoromethanesulfonate (PubChem CID 127033802) has the molecular formula C19H23F3O3S and a molecular weight of 388.45 g/mol. Its IUPAC name is [4-[(1E,3S)-3-ethenyl-3,7-dimethylocta-1,6-dienyl]phenyl] trifluoromethanesulfonate.
| Compound Name | [4-[(1E,3S)-3-ethenyl-3,7-dimethylocta-1,6-dienyl]phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 127033802 |
| Molecular Formula | C19H23F3O3S |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | [4-[(1E,3S)-3-ethenyl-3,7-dimethylocta-1,6-dienyl]phenyl] trifluoromethanesulfonate |
| SMILES | C=C[C@@](C)(/C=C/c1ccc(OS(=O)(=O)C(F)(F)F)cc1)CCC=C(C)C |
| InChI | InChI=1S/C19H23F3O3S/c1-5-18(4,13-6-7-15(2)3)14-12-16-8-10-17(11-9-16)25-26(23,24)19(20,21)22/h5,7-12,14H,1,6,13H2,2-4H3/b14-12+/t18-/m1/s1 |
| InChIKey | MVAKLNMWIHDWDY-QIXNEVBVSA-N |
| XLogP | 5.87 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|