C25H25FN4O — CID 127033872
(1R,3R)-3-[3-(4-fluorophenyl)-1H-pyrazol-5-yl]-1-(oxan-4-yl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole (PubChem CID 127033872) has the molecular formula C25H25FN4O and a molecular weight of 416.50 g/mol. Its IUPAC name is (1R,3R)-3-[3-(4-fluorophenyl)-1H-pyrazol-5-yl]-1-(oxan-4-yl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole.
| Compound Name | (1R,3R)-3-[3-(4-fluorophenyl)-1H-pyrazol-5-yl]-1-(oxan-4-yl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole |
|---|---|
| PubChem CID | 127033872 |
| Molecular Formula | C25H25FN4O |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | (1R,3R)-3-[3-(4-fluorophenyl)-1H-pyrazol-5-yl]-1-(oxan-4-yl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole |
| SMILES | Fc1ccc(-c2cc([C@H]3Cc4c([nH]c5ccccc45)[C@@H](C4CCOCC4)N3)[nH]n2)cc1 |
| InChI | InChI=1S/C25H25FN4O/c26-17-7-5-15(6-8-17)21-14-23(30-29-21)22-13-19-18-3-1-2-4-20(18)27-25(19)24(28-22)16-9-11-31-12-10-16/h1-8,14,16,22,24,27-28H,9-13H2,(H,29,30)/t22-,24-/m1/s1 |
| InChIKey | UWOOOJUEPGGPCJ-ISKFKSNPSA-N |
| XLogP | 5.05 |
| TPSA | 65.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|