C30H46O4 — CID 127033948
(2S,8S,9R,10R,13R,14S,17S)-2-hydroxy-17-[(2S)-2-hydroxy-6-methylhept-5-en-2-yl]-4,4,9,13,14-pentamethyl-2,7,8,10,12,15,16,17-octahydro-1H-cyclopenta[a]phenanthrene-3,11-dione (PubChem CID 127033948) has the molecular formula C30H46O4 and a molecular weight of 470.69 g/mol. Its IUPAC name is (2S,8S,9R,10R,13R,14S,17S)-2-hydroxy-17-[(2S)-2-hydroxy-6-methylhept-5-en-2-yl]-4,4,9,13,14-pentamethyl-2,7,8,10,12,15,16,17-octahydro-1H-cyclopenta[a]phenanthrene-3,11-dione.
| Compound Name | (2S,8S,9R,10R,13R,14S,17S)-2-hydroxy-17-[(2S)-2-hydroxy-6-methylhept-5-en-2-yl]-4,4,9,13,14-pentamethyl-2,7,8,10,12,15,16,17-octahydro-1H-cyclopenta[a]phenanthrene-3,11-dione |
|---|---|
| PubChem CID | 127033948 |
| Molecular Formula | C30H46O4 |
| Molecular Weight | 470.69 g/mol |
| Exact Mass | 470.34 |
| IUPAC Name | (2S,8S,9R,10R,13R,14S,17S)-2-hydroxy-17-[(2S)-2-hydroxy-6-methylhept-5-en-2-yl]-4,4,9,13,14-pentamethyl-2,7,8,10,12,15,16,17-octahydro-1H-cyclopenta[a]phenanthrene-3,11-dione |
| SMILES | CC(C)=CCC[C@](C)(O)[C@H]1CC[C@@]2(C)[C@@H]3CC=C4[C@@H](C[C@H](O)C(=O)C4(C)C)[C@]3(C)C(=O)C[C@]12C |
| InChI | InChI=1S/C30H46O4/c1-18(2)10-9-14-29(7,34)22-13-15-27(5)23-12-11-19-20(16-21(31)25(33)26(19,3)4)30(23,8)24(32)17-28(22,27)6/h10-11,20-23,31,34H,9,12-17H2,1-8H3/t20-,21+,22+,23+,27+,28-,29+,30+/m1/s1 |
| InChIKey | DARKMVCHZDFBML-KXYYXTSXSA-N |
| XLogP | 5.81 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.69 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|