C24H22N4O5S — CID 127033959
2-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)-N-[(4-sulfamoylphenyl)methyl]acetamide (PubChem CID 127033959) has the molecular formula C24H22N4O5S and a molecular weight of 478.53 g/mol. Its IUPAC name is 2-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)-N-[(4-sulfamoylphenyl)methyl]acetamide.
| Compound Name | 2-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)-N-[(4-sulfamoylphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 127033959 |
| Molecular Formula | C24H22N4O5S |
| Molecular Weight | 478.53 g/mol |
| Exact Mass | 478.13 |
| IUPAC Name | 2-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)-N-[(4-sulfamoylphenyl)methyl]acetamide |
| SMILES | NS(=O)(=O)c1ccc(CNC(=O)CN2C(=O)NC(c3ccccc3)(c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C24H22N4O5S/c25-34(32,33)20-13-11-17(12-14-20)15-26-21(29)16-28-22(30)24(27-23(28)31,18-7-3-1-4-8-18)19-9-5-2-6-10-19/h1-14H,15-16H2,(H,26,29)(H,27,31)(H2,25,32,33) |
| InChIKey | NGZCUAPCJNBUEU-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 138.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.53 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|