About 3,4-dimethyl-5-[(E)-3-(3-nitrophenyl)prop-2-enoyl]-6-phenyl-1,6-dihydropyrimidin-2-one
3,4-dimethyl-5-[(E)-3-(3-nitrophenyl)prop-2-enoyl]-6-phenyl-1,6-dihydropyrimidin-2-one (PubChem CID 127033970) has the molecular formula C21H19N3O4
and a molecular weight of 377.40 g/mol. Its IUPAC name is 3,4-dimethyl-5-[(E)-3-(3-nitrophenyl)prop-2-enoyl]-6-phenyl-1,6-dihydropyrimidin-2-one.
Molecular Properties
| Compound Name | 3,4-dimethyl-5-[(E)-3-(3-nitrophenyl)prop-2-enoyl]-6-phenyl-1,6-dihydropyrimidin-2-one |
| PubChem CID | 127033970 |
| Molecular Formula | C21H19N3O4 |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | 3,4-dimethyl-5-[(E)-3-(3-nitrophenyl)prop-2-enoyl]-6-phenyl-1,6-dihydropyrimidin-2-one |
| SMILES | CC1=C(C(=O)/C=C/c2cccc([N+](=O)[O-])c2)C(c2ccccc2)NC(=O)N1C |
| InChI | InChI=1S/C21H19N3O4/c1-14-19(18(25)12-11-15-7-6-10-17(13-15)24(27)28)20(22-21(26)23(14)2)16-8-4-3-5-9-16/h3-13,20H,1-2H3,(H,22,26)/b12-11+ |
| InChIKey | KYJZUOCHEIUCOO-VAWYXSNFSA-N |
| XLogP | 3.85 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3,4-dimethyl-5-[(E)-3-(3-nitrophenyl)prop-2-enoyl]-6-phenyl-1,6-dihydropyrimidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dimethyl-5-[(E)-3-(3-nitrophenyl)prop-2-enoyl]-6-phenyl-1,6-dihydropyrimidin-2-one?
The IUPAC name of 3,4-dimethyl-5-[(E)-3-(3-nitrophenyl)prop-2-enoyl]-6-phenyl-1,6-dihydropyrimidin-2-one (CID 127033970) is 3,4-dimethyl-5-[(E)-3-(3-nitrophenyl)prop-2-enoyl]-6-phenyl-1,6-dihydropyrimidin-2-one.
What is the SMILES notation for 3,4-dimethyl-5-[(E)-3-(3-nitrophenyl)prop-2-enoyl]-6-phenyl-1,6-dihydropyrimidin-2-one?
The canonical SMILES for 3,4-dimethyl-5-[(E)-3-(3-nitrophenyl)prop-2-enoyl]-6-phenyl-1,6-dihydropyrimidin-2-one is CC1=C(C(=O)/C=C/c2cccc([N+](=O)[O-])c2)C(c2ccccc2)NC(=O)N1C.
What is the InChIKey of 3,4-dimethyl-5-[(E)-3-(3-nitrophenyl)prop-2-enoyl]-6-phenyl-1,6-dihydropyrimidin-2-one?
The InChIKey is KYJZUOCHEIUCOO-VAWYXSNFSA-N. The full InChI is InChI=1S/C21H19N3O4/c1-14-19(18(25)12-11-15-7-6-10-17(13-15)24(27)28)20(22-21(26)23(14)2)16-8-4-3-5-9-16/h3-13,20H,1-2H3,(H,22,26)/b12-11+.
What are the key properties of 3,4-dimethyl-5-[(E)-3-(3-nitrophenyl)prop-2-enoyl]-6-phenyl-1,6-dihydropyrimidin-2-one?
3,4-dimethyl-5-[(E)-3-(3-nitrophenyl)prop-2-enoyl]-6-phenyl-1,6-dihydropyrimidin-2-one has a molecular weight of 377.40 g/mol, XLogP of 3.85, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dimethyl-5-[(E)-3-(3-nitrophenyl)prop-2-enoyl]-6-phenyl-1,6-dihydropyrimidin-2-one is sourced from PubChem (CID 127033970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).