C19H18N4O3 — CID 127034001
1-(6-formyl-2-pyridinyl)-3-(6-oxo-2,3,4,10b-tetrahydro-1H-pyrido[2,1-a]isoindol-10-yl)urea (PubChem CID 127034001) has the molecular formula C19H18N4O3 and a molecular weight of 350.38 g/mol. Its IUPAC name is 1-(6-formyl-2-pyridinyl)-3-(6-oxo-2,3,4,10b-tetrahydro-1H-pyrido[2,1-a]isoindol-10-yl)urea.
| Compound Name | 1-(6-formyl-2-pyridinyl)-3-(6-oxo-2,3,4,10b-tetrahydro-1H-pyrido[2,1-a]isoindol-10-yl)urea |
|---|---|
| PubChem CID | 127034001 |
| Molecular Formula | C19H18N4O3 |
| Molecular Weight | 350.38 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | 1-(6-formyl-2-pyridinyl)-3-(6-oxo-2,3,4,10b-tetrahydro-1H-pyrido[2,1-a]isoindol-10-yl)urea |
| SMILES | O=Cc1cccc(NC(=O)Nc2cccc3c2C2CCCCN2C3=O)n1 |
| InChI | InChI=1S/C19H18N4O3/c24-11-12-5-3-9-16(20-12)22-19(26)21-14-7-4-6-13-17(14)15-8-1-2-10-23(15)18(13)25/h3-7,9,11,15H,1-2,8,10H2,(H2,20,21,22,26) |
| InChIKey | MZWFSHNLGOBBSZ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.38 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|