C27H33N5O4 — CID 127034067
N-[(7-methoxy-4,4-dimethylchromeno[3,4-d]pyrazol-1-yl)methyl]-2-[4-(4-methoxyphenyl)piperazin-1-yl]acetamide (PubChem CID 127034067) has the molecular formula C27H33N5O4 and a molecular weight of 491.59 g/mol. Its IUPAC name is N-[(7-methoxy-4,4-dimethylchromeno[3,4-d]pyrazol-1-yl)methyl]-2-[4-(4-methoxyphenyl)piperazin-1-yl]acetamide.
| Compound Name | N-[(7-methoxy-4,4-dimethylchromeno[3,4-d]pyrazol-1-yl)methyl]-2-[4-(4-methoxyphenyl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 127034067 |
| Molecular Formula | C27H33N5O4 |
| Molecular Weight | 491.59 g/mol |
| Exact Mass | 491.25 |
| IUPAC Name | N-[(7-methoxy-4,4-dimethylchromeno[3,4-d]pyrazol-1-yl)methyl]-2-[4-(4-methoxyphenyl)piperazin-1-yl]acetamide |
| SMILES | COc1ccc(N2CCN(CC(=O)NCn3ncc4c3-c3ccc(OC)cc3OC4(C)C)CC2)cc1 |
| InChI | InChI=1S/C27H33N5O4/c1-27(2)23-16-29-32(26(23)22-10-9-21(35-4)15-24(22)36-27)18-28-25(33)17-30-11-13-31(14-12-30)19-5-7-20(34-3)8-6-19/h5-10,15-16H,11-14,17-18H2,1-4H3,(H,28,33) |
| InChIKey | OGCYKMRKHKZCCI-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 81.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.59 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|