C30H44O5 — CID 127034222
(2S,8S,9R,10R,13R,14S,17S)-2-hydroxy-17-[(2R)-2-hydroxy-6-methyl-3-oxohept-5-en-2-yl]-4,4,9,13,14-pentamethyl-2,7,8,10,12,15,16,17-octahydro-1H-cyclopenta[a]phenanthrene-3,11-dione (PubChem CID 127034222) has the molecular formula C30H44O5 and a molecular weight of 484.68 g/mol. Its IUPAC name is (2S,8S,9R,10R,13R,14S,17S)-2-hydroxy-17-[(2R)-2-hydroxy-6-methyl-3-oxohept-5-en-2-yl]-4,4,9,13,14-pentamethyl-2,7,8,10,12,15,16,17-octahydro-1H-cyclopenta[a]phenanthrene-3,11-dione.
| Compound Name | (2S,8S,9R,10R,13R,14S,17S)-2-hydroxy-17-[(2R)-2-hydroxy-6-methyl-3-oxohept-5-en-2-yl]-4,4,9,13,14-pentamethyl-2,7,8,10,12,15,16,17-octahydro-1H-cyclopenta[a]phenanthrene-3,11-dione |
|---|---|
| PubChem CID | 127034222 |
| Molecular Formula | C30H44O5 |
| Molecular Weight | 484.68 g/mol |
| Exact Mass | 484.32 |
| IUPAC Name | (2S,8S,9R,10R,13R,14S,17S)-2-hydroxy-17-[(2R)-2-hydroxy-6-methyl-3-oxohept-5-en-2-yl]-4,4,9,13,14-pentamethyl-2,7,8,10,12,15,16,17-octahydro-1H-cyclopenta[a]phenanthrene-3,11-dione |
| SMILES | CC(C)=CCC(=O)[C@](C)(O)[C@H]1CC[C@@]2(C)[C@@H]3CC=C4[C@@H](C[C@H](O)C(=O)C4(C)C)[C@]3(C)C(=O)C[C@]12C |
| InChI | InChI=1S/C30H44O5/c1-17(2)9-12-23(32)30(8,35)22-13-14-27(5)21-11-10-18-19(15-20(31)25(34)26(18,3)4)29(21,7)24(33)16-28(22,27)6/h9-10,19-22,31,35H,11-16H2,1-8H3/t19-,20+,21+,22+,27+,28-,29+,30-/m1/s1 |
| InChIKey | FRWOSWUBGLNXJU-IRIAOCASSA-N |
| XLogP | 4.99 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.68 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|