About 7-chloro-4-(4-methylpiperazin-1-yl)thieno[3,4-b][1,5]benzothiazepine
7-chloro-4-(4-methylpiperazin-1-yl)thieno[3,4-b][1,5]benzothiazepine (PubChem CID 12703439) has the molecular formula C16H16ClN3S2
and a molecular weight of 349.91 g/mol. Its IUPAC name is 7-chloro-4-(4-methylpiperazin-1-yl)thieno[3,4-b][1,5]benzothiazepine.
Molecular Properties
| Compound Name | 7-chloro-4-(4-methylpiperazin-1-yl)thieno[3,4-b][1,5]benzothiazepine |
| PubChem CID | 12703439 |
| Molecular Formula | C16H16ClN3S2 |
| Molecular Weight | 349.91 g/mol |
| Exact Mass | 349.05 |
| IUPAC Name | 7-chloro-4-(4-methylpiperazin-1-yl)thieno[3,4-b][1,5]benzothiazepine |
| SMILES | CN1CCN(C2=Nc3cc(Cl)ccc3Sc3cscc32)CC1 |
| InChI | InChI=1S/C16H16ClN3S2/c1-19-4-6-20(7-5-19)16-12-9-21-10-15(12)22-14-3-2-11(17)8-13(14)18-16/h2-3,8-10H,4-7H2,1H3 |
| InChIKey | IFYXGXDRWYWMOJ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.91 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 7-chloro-4-(4-methylpiperazin-1-yl)thieno[3,4-b][1,5]benzothiazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-4-(4-methylpiperazin-1-yl)thieno[3,4-b][1,5]benzothiazepine?
The IUPAC name of 7-chloro-4-(4-methylpiperazin-1-yl)thieno[3,4-b][1,5]benzothiazepine (CID 12703439) is 7-chloro-4-(4-methylpiperazin-1-yl)thieno[3,4-b][1,5]benzothiazepine.
What is the SMILES notation for 7-chloro-4-(4-methylpiperazin-1-yl)thieno[3,4-b][1,5]benzothiazepine?
The canonical SMILES for 7-chloro-4-(4-methylpiperazin-1-yl)thieno[3,4-b][1,5]benzothiazepine is CN1CCN(C2=Nc3cc(Cl)ccc3Sc3cscc32)CC1.
What is the InChIKey of 7-chloro-4-(4-methylpiperazin-1-yl)thieno[3,4-b][1,5]benzothiazepine?
The InChIKey is IFYXGXDRWYWMOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16ClN3S2/c1-19-4-6-20(7-5-19)16-12-9-21-10-15(12)22-14-3-2-11(17)8-13(14)18-16/h2-3,8-10H,4-7H2,1H3.
What are the key properties of 7-chloro-4-(4-methylpiperazin-1-yl)thieno[3,4-b][1,5]benzothiazepine?
7-chloro-4-(4-methylpiperazin-1-yl)thieno[3,4-b][1,5]benzothiazepine has a molecular weight of 349.91 g/mol, XLogP of 4.19, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-4-(4-methylpiperazin-1-yl)thieno[3,4-b][1,5]benzothiazepine is sourced from PubChem (CID 12703439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).