About (E)-3-(2,3-dichlorophenyl)-N-[(4-fluorophenyl)methyl]prop-2-enamide
(E)-3-(2,3-dichlorophenyl)-N-[(4-fluorophenyl)methyl]prop-2-enamide (PubChem CID 127034449) has the molecular formula C16H12Cl2FNO
and a molecular weight of 324.18 g/mol. Its IUPAC name is (E)-3-(2,3-dichlorophenyl)-N-[(4-fluorophenyl)methyl]prop-2-enamide.
Molecular Properties
| Compound Name | (E)-3-(2,3-dichlorophenyl)-N-[(4-fluorophenyl)methyl]prop-2-enamide |
| PubChem CID | 127034449 |
| Molecular Formula | C16H12Cl2FNO |
| Molecular Weight | 324.18 g/mol |
| Exact Mass | 323.03 |
| IUPAC Name | (E)-3-(2,3-dichlorophenyl)-N-[(4-fluorophenyl)methyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1cccc(Cl)c1Cl)NCc1ccc(F)cc1 |
| InChI | InChI=1S/C16H12Cl2FNO/c17-14-3-1-2-12(16(14)18)6-9-15(21)20-10-11-4-7-13(19)8-5-11/h1-9H,10H2,(H,20,21)/b9-6+ |
| InChIKey | QUESOTHKSVEUIB-RMKNXTFCSA-N |
| XLogP | 4.46 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.18 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-(2,3-dichlorophenyl)-N-[(4-fluorophenyl)methyl]prop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-(2,3-dichlorophenyl)-N-[(4-fluorophenyl)methyl]prop-2-enamide?
The IUPAC name of (E)-3-(2,3-dichlorophenyl)-N-[(4-fluorophenyl)methyl]prop-2-enamide (CID 127034449) is (E)-3-(2,3-dichlorophenyl)-N-[(4-fluorophenyl)methyl]prop-2-enamide.
What is the SMILES notation for (E)-3-(2,3-dichlorophenyl)-N-[(4-fluorophenyl)methyl]prop-2-enamide?
The canonical SMILES for (E)-3-(2,3-dichlorophenyl)-N-[(4-fluorophenyl)methyl]prop-2-enamide is O=C(/C=C/c1cccc(Cl)c1Cl)NCc1ccc(F)cc1.
What is the InChIKey of (E)-3-(2,3-dichlorophenyl)-N-[(4-fluorophenyl)methyl]prop-2-enamide?
The InChIKey is QUESOTHKSVEUIB-RMKNXTFCSA-N. The full InChI is InChI=1S/C16H12Cl2FNO/c17-14-3-1-2-12(16(14)18)6-9-15(21)20-10-11-4-7-13(19)8-5-11/h1-9H,10H2,(H,20,21)/b9-6+.
What are the key properties of (E)-3-(2,3-dichlorophenyl)-N-[(4-fluorophenyl)methyl]prop-2-enamide?
(E)-3-(2,3-dichlorophenyl)-N-[(4-fluorophenyl)methyl]prop-2-enamide has a molecular weight of 324.18 g/mol, XLogP of 4.46, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-(2,3-dichlorophenyl)-N-[(4-fluorophenyl)methyl]prop-2-enamide is sourced from PubChem (CID 127034449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).