C20H20N4O3 — CID 127034542
N-methyl-1-(2,4,6-trimethoxyphenyl)imidazo[1,2-a]quinoxalin-4-amine (PubChem CID 127034542) has the molecular formula C20H20N4O3 and a molecular weight of 364.41 g/mol. Its IUPAC name is N-methyl-1-(2,4,6-trimethoxyphenyl)imidazo[1,2-a]quinoxalin-4-amine.
| Compound Name | N-methyl-1-(2,4,6-trimethoxyphenyl)imidazo[1,2-a]quinoxalin-4-amine |
|---|---|
| PubChem CID | 127034542 |
| Molecular Formula | C20H20N4O3 |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | N-methyl-1-(2,4,6-trimethoxyphenyl)imidazo[1,2-a]quinoxalin-4-amine |
| SMILES | CNc1nc2ccccc2n2c(-c3c(OC)cc(OC)cc3OC)cnc12 |
| InChI | InChI=1S/C20H20N4O3/c1-21-19-20-22-11-15(24(20)14-8-6-5-7-13(14)23-19)18-16(26-3)9-12(25-2)10-17(18)27-4/h5-11H,1-4H3,(H,21,23) |
| InChIKey | OENXEXIETUMPTF-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 69.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |